C19H15ClN4O2S — CID 141329544
N-(6-chloro-3-pyridinyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide (PubChem CID 141329544) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 141329544 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
| SMILES | COc1ccc(-c2cn3c(CC(=O)Nc4ccc(Cl)nc4)csc3n2)cc1 |
| InChI | InChI=1S/C19H15ClN4O2S/c1-26-15-5-2-12(3-6-15)16-10-24-14(11-27-19(24)23-16)8-18(25)22-13-4-7-17(20)21-9-13/h2-7,9-11H,8H2,1H3,(H,22,25) |
| InChIKey | HOVUQPXZBQWCNX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|