C19H16F2N2O4 — CID 141330444
(2,4-difluorophenyl)-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone (PubChem CID 141330444) has the molecular formula C19H16F2N2O4 and a molecular weight of 374.34 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 141330444 |
| Molecular Formula | C19H16F2N2O4 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2,4-difluorophenyl)-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1F)C1CCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H16F2N2O4/c20-14-4-5-16(17(21)11-14)18(24)12-6-8-22(9-7-12)19(25)13-2-1-3-15(10-13)23(26)27/h1-5,10-12H,6-9H2 |
| InChIKey | WBXSOIGUYVAQEA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|