About 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine
2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine (PubChem CID 141330614) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine |
| PubChem CID | 141330614 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine |
| SMILES | COc1cc(CCN)cc2c1ONO2 |
| InChI | InChI=1S/C9H12N2O3/c1-12-7-4-6(2-3-10)5-8-9(7)14-11-13-8/h4-5,11H,2-3,10H2,1H3 |
| InChIKey | APYZBMVSBSCEOZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine?
The IUPAC name of 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine (CID 141330614) is 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine.
What is the SMILES notation for 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine?
The canonical SMILES for 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine is COc1cc(CCN)cc2c1ONO2.
What is the InChIKey of 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine?
The InChIKey is APYZBMVSBSCEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-12-7-4-6(2-3-10)5-8-9(7)14-11-13-8/h4-5,11H,2-3,10H2,1H3.
What are the key properties of 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine?
2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine has a molecular weight of 196.21 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-1,3,2-benzodioxazol-6-yl)ethanamine is sourced from PubChem (CID 141330614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).