About 3,7-dihydropurine-2,6-dione;dihydrochloride
3,7-dihydropurine-2,6-dione;dihydrochloride (PubChem CID 141330661) has the molecular formula C5H6Cl2N4O2
and a molecular weight of 225.04 g/mol. Its IUPAC name is 3,7-dihydropurine-2,6-dione;dihydrochloride.
Molecular Properties
| Compound Name | 3,7-dihydropurine-2,6-dione;dihydrochloride |
| PubChem CID | 141330661 |
| Molecular Formula | C5H6Cl2N4O2 |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 3,7-dihydropurine-2,6-dione;dihydrochloride |
| SMILES | Cl.Cl.O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4O2.2ClH/c10-4-2-3(7-1-6-2)8-5(11)9-4;;/h1H,(H3,6,7,8,9,10,11);2*1H |
| InChIKey | QCJLNKIGEAZZQI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dihydropurine-2,6-dione;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydropurine-2,6-dione;dihydrochloride?
The IUPAC name of 3,7-dihydropurine-2,6-dione;dihydrochloride (CID 141330661) is 3,7-dihydropurine-2,6-dione;dihydrochloride.
What is the SMILES notation for 3,7-dihydropurine-2,6-dione;dihydrochloride?
The canonical SMILES for 3,7-dihydropurine-2,6-dione;dihydrochloride is Cl.Cl.O=c1[nH]c(=O)c2[nH]cnc2[nH]1.
What is the InChIKey of 3,7-dihydropurine-2,6-dione;dihydrochloride?
The InChIKey is QCJLNKIGEAZZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2.2ClH/c10-4-2-3(7-1-6-2)8-5(11)9-4;;/h1H,(H3,6,7,8,9,10,11);2*1H.
What are the key properties of 3,7-dihydropurine-2,6-dione;dihydrochloride?
3,7-dihydropurine-2,6-dione;dihydrochloride has a molecular weight of 225.04 g/mol, XLogP of -0.22, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydropurine-2,6-dione;dihydrochloride is sourced from PubChem (CID 141330661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).