C23H31N3O4S — CID 141330792
methyl 2,4,4-trimethyl-2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]pentanoate (PubChem CID 141330792) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is methyl 2,4,4-trimethyl-2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]pentanoate.
| Compound Name | methyl 2,4,4-trimethyl-2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 141330792 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | methyl 2,4,4-trimethyl-2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]pentanoate |
| SMILES | COC(=O)C(C)(CC(C)(C)C)N1CCC(c2ncc(-c3ccc([N+](=O)[O-])cc3)s2)CC1 |
| InChI | InChI=1S/C23H31N3O4S/c1-22(2,3)15-23(4,21(27)30-5)25-12-10-17(11-13-25)20-24-14-19(31-20)16-6-8-18(9-7-16)26(28)29/h6-9,14,17H,10-13,15H2,1-5H3 |
| InChIKey | ROAWSTCHQVWRFP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|