C17H27NO6 — CID 14133212
1-O-tert-butyl 2-O-methyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate (PubChem CID 14133212) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14133212 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(C)[C@H]1CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C17H27NO6/c1-10(2)12-9-18(16(21)24-17(3,4)5)14(15(20)23-7)11(12)8-13(19)22-6/h11-12,14H,1,8-9H2,2-7H3/t11-,12+,14-/m0/s1 |
| InChIKey | SGXHLGYAHBMPFX-SCRDCRAPSA-N |
| XLogP | 2.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|