C16H23F3N2O5 — CID 141332250
1-O-tert-butyl 3-O-methyl 2-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1,3-dicarboxylate (PubChem CID 141332250) has the molecular formula C16H23F3N2O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 2-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 2-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 141332250 |
| Molecular Formula | C16H23F3N2O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 2-prop-2-enyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1,3-dicarboxylate |
| SMILES | C=CCC1N(C(=O)OC(C)(C)C)CCC1(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C16H23F3N2O5/c1-6-7-10-15(12(23)25-5,20-11(22)16(17,18)19)8-9-21(10)13(24)26-14(2,3)4/h6,10H,1,7-9H2,2-5H3,(H,20,22) |
| InChIKey | JOVANZSLFWGIQI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|