About (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine
(3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine (PubChem CID 141333018) has the molecular formula C12H14ClFN2
and a molecular weight of 240.71 g/mol. Its IUPAC name is (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine.
Molecular Properties
| Compound Name | (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine |
| PubChem CID | 141333018 |
| Molecular Formula | C12H14ClFN2 |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine |
| SMILES | Cc1cc([C@]2(C)C=C(N)NC2)c(F)cc1Cl |
| InChI | InChI=1S/C12H14ClFN2/c1-7-3-8(10(14)4-9(7)13)12(2)5-11(15)16-6-12/h3-5,16H,6,15H2,1-2H3/t12-/m1/s1 |
| InChIKey | FECOJEJTJDTYCL-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine?
The IUPAC name of (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine (CID 141333018) is (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine.
What is the SMILES notation for (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine?
The canonical SMILES for (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine is Cc1cc([C@]2(C)C=C(N)NC2)c(F)cc1Cl.
What is the InChIKey of (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine?
The InChIKey is FECOJEJTJDTYCL-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H14ClFN2/c1-7-3-8(10(14)4-9(7)13)12(2)5-11(15)16-6-12/h3-5,16H,6,15H2,1-2H3/t12-/m1/s1.
What are the key properties of (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine?
(3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine has a molecular weight of 240.71 g/mol, XLogP of 2.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-chloro-2-fluoro-5-methylphenyl)-3-methyl-1,2-dihydropyrrol-5-amine is sourced from PubChem (CID 141333018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).