About 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol
2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol (PubChem CID 141333237) has the molecular formula C7H10ClN5O
and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol |
| PubChem CID | 141333237 |
| Molecular Formula | C7H10ClN5O |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol |
| SMILES | Nc1nc(Cl)c2c(n1)N(CCO)CN2 |
| InChI | InChI=1S/C7H10ClN5O/c8-5-4-6(12-7(9)11-5)13(1-2-14)3-10-4/h10,14H,1-3H2,(H2,9,11,12) |
| InChIKey | XVEYKCNPGUEHAN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol?
The IUPAC name of 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol (CID 141333237) is 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol.
What is the SMILES notation for 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol?
The canonical SMILES for 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol is Nc1nc(Cl)c2c(n1)N(CCO)CN2.
What is the InChIKey of 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol?
The InChIKey is XVEYKCNPGUEHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN5O/c8-5-4-6(12-7(9)11-5)13(1-2-14)3-10-4/h10,14H,1-3H2,(H2,9,11,12).
What are the key properties of 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol?
2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol has a molecular weight of 215.64 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-6-chloro-7,8-dihydropurin-9-yl)ethanol is sourced from PubChem (CID 141333237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).