C9H5F8N5 — CID 141333388
1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]triazole (PubChem CID 141333388) has the molecular formula C9H5F8N5 and a molecular weight of 335.16 g/mol. Its IUPAC name is 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]triazole.
| Compound Name | 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]triazole |
|---|---|
| PubChem CID | 141333388 |
| Molecular Formula | C9H5F8N5 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]triazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1ccnn1 |
| InChI | InChI=1S/C9H5F8N5/c1-21-6(22-3-2-18-20-22)4(8(12,13)14)5(19-21)7(10,11)9(15,16)17/h2-3H,1H3 |
| InChIKey | LWFURRIRHHRVJB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|