About 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione
7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione (PubChem CID 141334323) has the molecular formula C13H8N2O4S
and a molecular weight of 288.28 g/mol. Its IUPAC name is 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione.
Molecular Properties
| Compound Name | 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione |
| PubChem CID | 141334323 |
| Molecular Formula | C13H8N2O4S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione |
| SMILES | CCc1cnc2c(c1)C(=O)c1sc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C13H8N2O4S/c1-2-6-3-7-10(14-5-6)11(16)8-4-9(15(18)19)20-13(8)12(7)17/h3-5H,2H2,1H3 |
| InChIKey | QHORDUDGGPSMMJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione?
The IUPAC name of 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione (CID 141334323) is 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione.
What is the SMILES notation for 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione?
The canonical SMILES for 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione is CCc1cnc2c(c1)C(=O)c1sc([N+](=O)[O-])cc1C2=O.
What is the InChIKey of 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione?
The InChIKey is QHORDUDGGPSMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O4S/c1-2-6-3-7-10(14-5-6)11(16)8-4-9(15(18)19)20-13(8)12(7)17/h3-5H,2H2,1H3.
What are the key properties of 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione?
7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione has a molecular weight of 288.28 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-nitrothieno[2,3-g]quinoline-4,9-dione is sourced from PubChem (CID 141334323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).