C25H36N2O — CID 141334597
(2,6-diamino-3,5-dipropylphenyl)-(3,5-dipropylphenyl)methanone (PubChem CID 141334597) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (2,6-diamino-3,5-dipropylphenyl)-(3,5-dipropylphenyl)methanone.
| Compound Name | (2,6-diamino-3,5-dipropylphenyl)-(3,5-dipropylphenyl)methanone |
|---|---|
| PubChem CID | 141334597 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (2,6-diamino-3,5-dipropylphenyl)-(3,5-dipropylphenyl)methanone |
| SMILES | CCCc1cc(CCC)cc(C(=O)c2c(N)c(CCC)cc(CCC)c2N)c1 |
| InChI | InChI=1S/C25H36N2O/c1-5-9-17-13-18(10-6-2)15-21(14-17)25(28)22-23(26)19(11-7-3)16-20(12-8-4)24(22)27/h13-16H,5-12,26-27H2,1-4H3 |
| InChIKey | PLFZLWQRSRJXAY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|