About N,N'-bis(2,2-dimethoxyethyl)pentanediamide
N,N'-bis(2,2-dimethoxyethyl)pentanediamide (PubChem CID 141334865) has the molecular formula C13H26N2O6
and a molecular weight of 306.36 g/mol. Its IUPAC name is N,N'-bis(2,2-dimethoxyethyl)pentanediamide.
Molecular Properties
| Compound Name | N,N'-bis(2,2-dimethoxyethyl)pentanediamide |
| PubChem CID | 141334865 |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N,N'-bis(2,2-dimethoxyethyl)pentanediamide |
| SMILES | COC(CNC(=O)CCCC(=O)NCC(OC)OC)OC |
| InChI | InChI=1S/C13H26N2O6/c1-18-12(19-2)8-14-10(16)6-5-7-11(17)15-9-13(20-3)21-4/h12-13H,5-9H2,1-4H3,(H,14,16)(H,15,17) |
| InChIKey | ZGDBZXOCOQSFIT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2,2-dimethoxyethyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2,2-dimethoxyethyl)pentanediamide?
The IUPAC name of N,N'-bis(2,2-dimethoxyethyl)pentanediamide (CID 141334865) is N,N'-bis(2,2-dimethoxyethyl)pentanediamide.
What is the SMILES notation for N,N'-bis(2,2-dimethoxyethyl)pentanediamide?
The canonical SMILES for N,N'-bis(2,2-dimethoxyethyl)pentanediamide is COC(CNC(=O)CCCC(=O)NCC(OC)OC)OC.
What is the InChIKey of N,N'-bis(2,2-dimethoxyethyl)pentanediamide?
The InChIKey is ZGDBZXOCOQSFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O6/c1-18-12(19-2)8-14-10(16)6-5-7-11(17)15-9-13(20-3)21-4/h12-13H,5-9H2,1-4H3,(H,14,16)(H,15,17).
What are the key properties of N,N'-bis(2,2-dimethoxyethyl)pentanediamide?
N,N'-bis(2,2-dimethoxyethyl)pentanediamide has a molecular weight of 306.36 g/mol, XLogP of -0.37, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2,2-dimethoxyethyl)pentanediamide is sourced from PubChem (CID 141334865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).