C11H15F3N4O2 — CID 141335246
N-(3-methoxypiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-2-carboxamide (PubChem CID 141335246) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is N-(3-methoxypiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-2-carboxamide.
| Compound Name | N-(3-methoxypiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 141335246 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(3-methoxypiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-2-carboxamide |
| SMILES | COC1CNCCC1NC(=O)c1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H15F3N4O2/c1-20-7-4-15-3-2-6(7)17-10(19)9-16-5-8(18-9)11(12,13)14/h5-7,15H,2-4H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | ILPFRAIBLVLQAL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |