About 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine
3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine (PubChem CID 141335553) has the molecular formula C18H18FN5
and a molecular weight of 323.38 g/mol. Its IUPAC name is 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine |
| PubChem CID | 141335553 |
| Molecular Formula | C18H18FN5 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine |
| SMILES | NCCCn1cc2c(n1)-c1nc(-c3ccc(F)cc3)ncc1CC2 |
| InChI | InChI=1S/C18H18FN5/c19-15-6-4-12(5-7-15)18-21-10-13-2-3-14-11-24(9-1-8-20)23-17(14)16(13)22-18/h4-7,10-11H,1-3,8-9,20H2 |
| InChIKey | NZWSICLSOBMLKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine?
The IUPAC name of 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine (CID 141335553) is 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine.
What is the SMILES notation for 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine?
The canonical SMILES for 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine is NCCCn1cc2c(n1)-c1nc(-c3ccc(F)cc3)ncc1CC2.
What is the InChIKey of 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine?
The InChIKey is NZWSICLSOBMLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN5/c19-15-6-4-12(5-7-15)18-21-10-13-2-3-14-11-24(9-1-8-20)23-17(14)16(13)22-18/h4-7,10-11H,1-3,8-9,20H2.
What are the key properties of 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine?
3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine has a molecular weight of 323.38 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propan-1-amine is sourced from PubChem (CID 141335553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).