About 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine
3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 141336127) has the molecular formula C16H17F5N2
and a molecular weight of 332.32 g/mol. Its IUPAC name is 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| PubChem CID | 141336127 |
| Molecular Formula | C16H17F5N2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccc2nc(C(F)(F)F)c(CC3CCC(F)(F)CC3)n12 |
| InChI | InChI=1S/C16H17F5N2/c1-10-3-2-4-13-22-14(16(19,20)21)12(23(10)13)9-11-5-7-15(17,18)8-6-11/h2-4,11H,5-9H2,1H3 |
| InChIKey | XDYOMHAEDIUXRW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine?
The IUPAC name of 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine (CID 141336127) is 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine is Cc1cccc2nc(C(F)(F)F)c(CC3CCC(F)(F)CC3)n12.
What is the InChIKey of 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine?
The InChIKey is XDYOMHAEDIUXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F5N2/c1-10-3-2-4-13-22-14(16(19,20)21)12(23(10)13)9-11-5-7-15(17,18)8-6-11/h2-4,11H,5-9H2,1H3.
What are the key properties of 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine?
3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine has a molecular weight of 332.32 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-difluorocyclohexyl)methyl]-5-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 141336127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).