About N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide
N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 141338552) has the molecular formula C15H15F3N2O2
and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide |
| PubChem CID | 141338552 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1(Cn2cc(C(F)(F)F)ccc2=O)C=CC=CC1 |
| InChI | InChI=1S/C15H15F3N2O2/c1-11(21)19-14(7-3-2-4-8-14)10-20-9-12(15(16,17)18)5-6-13(20)22/h2-7,9H,8,10H2,1H3,(H,19,21) |
| InChIKey | FRORLAYXXSPTHP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide?
The IUPAC name of N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide (CID 141338552) is N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide.
What is the SMILES notation for N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide?
The canonical SMILES for N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide is CC(=O)NC1(Cn2cc(C(F)(F)F)ccc2=O)C=CC=CC1.
What is the InChIKey of N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide?
The InChIKey is FRORLAYXXSPTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O2/c1-11(21)19-14(7-3-2-4-8-14)10-20-9-12(15(16,17)18)5-6-13(20)22/h2-7,9H,8,10H2,1H3,(H,19,21).
What are the key properties of N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide?
N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide has a molecular weight of 312.29 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]cyclohexa-2,4-dien-1-yl]acetamide is sourced from PubChem (CID 141338552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).