C16H32O3Si — CID 141338567
ethyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexane-1-carboxylate (PubChem CID 141338567) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is ethyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141338567 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-8-18-14(17)13-11-9-10-12-16(13,5)19-20(6,7)15(2,3)4/h13H,8-12H2,1-7H3 |
| InChIKey | MVQZSLTUNOJBNA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|