About 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline
6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 141339139) has the molecular formula C18H11NO3
and a molecular weight of 289.29 g/mol. Its IUPAC name is 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline |
| PubChem CID | 141339139 |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | c1ccc2c(-c3ccc4cc5c(cc4n3)OCO5)coc2c1 |
| InChI | InChI=1S/C18H11NO3/c1-2-4-16-12(3-1)13(9-20-16)14-6-5-11-7-17-18(22-10-21-17)8-15(11)19-14/h1-9H,10H2 |
| InChIKey | PJADDKOGKBKYOG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline?
The IUPAC name of 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline (CID 141339139) is 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline.
What is the SMILES notation for 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline?
The canonical SMILES for 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline is c1ccc2c(-c3ccc4cc5c(cc4n3)OCO5)coc2c1.
What is the InChIKey of 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline?
The InChIKey is PJADDKOGKBKYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO3/c1-2-4-16-12(3-1)13(9-20-16)14-6-5-11-7-17-18(22-10-21-17)8-15(11)19-14/h1-9H,10H2.
What are the key properties of 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline?
6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline has a molecular weight of 289.29 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-benzofuran-3-yl)-[1,3]dioxolo[4,5-g]quinoline is sourced from PubChem (CID 141339139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).