C25H46O3Si2 — CID 141339373
(3R,5R,7S,8R,9S,10S,13S,14S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 141339373) has the molecular formula C25H46O3Si2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (3R,5R,7S,8R,9S,10S,13S,14S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5R,7S,8R,9S,10S,13S,14S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 141339373 |
| Molecular Formula | C25H46O3Si2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (3R,5R,7S,8R,9S,10S,13S,14S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H](O[Si](C)(C)C)C[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H46O3Si2/c1-24-13-11-18(27-29(3,4)5)15-17(24)16-21(28-30(6,7)8)23-19-9-10-22(26)25(19,2)14-12-20(23)24/h17-21,23H,9-16H2,1-8H3/t17-,18-,19+,20+,21+,23+,24+,25+/m1/s1 |
| InChIKey | OQNWYSIBPMMGPY-ONLNNGLISA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|