C7H8F6 — CID 141339436
3,4,4,5,6,6-hexafluorohept-1-ene (PubChem CID 141339436) has the molecular formula C7H8F6 and a molecular weight of 206.13 g/mol. Its IUPAC name is 3,4,4,5,6,6-hexafluorohept-1-ene.
| Compound Name | 3,4,4,5,6,6-hexafluorohept-1-ene |
|---|---|
| PubChem CID | 141339436 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3,4,4,5,6,6-hexafluorohept-1-ene |
| SMILES | C=CC(F)C(F)(F)C(F)C(C)(F)F |
| InChI | InChI=1S/C7H8F6/c1-3-4(8)7(12,13)5(9)6(2,10)11/h3-5H,1H2,2H3 |
| InChIKey | CHTCEFFSAUNIOE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|