About ethyl 3-amino-2-oxohexanoate
ethyl 3-amino-2-oxohexanoate (PubChem CID 141339528) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is ethyl 3-amino-2-oxohexanoate.
Molecular Properties
| Compound Name | ethyl 3-amino-2-oxohexanoate |
| PubChem CID | 141339528 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethyl 3-amino-2-oxohexanoate |
| SMILES | CCCC(N)C(=O)C(=O)OCC |
| InChI | InChI=1S/C8H15NO3/c1-3-5-6(9)7(10)8(11)12-4-2/h6H,3-5,9H2,1-2H3 |
| InChIKey | YJWQEVYDCKLDII-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-2-oxohexanoate?
The IUPAC name of ethyl 3-amino-2-oxohexanoate (CID 141339528) is ethyl 3-amino-2-oxohexanoate.
What is the SMILES notation for ethyl 3-amino-2-oxohexanoate?
The canonical SMILES for ethyl 3-amino-2-oxohexanoate is CCCC(N)C(=O)C(=O)OCC.
What is the InChIKey of ethyl 3-amino-2-oxohexanoate?
The InChIKey is YJWQEVYDCKLDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-3-5-6(9)7(10)8(11)12-4-2/h6H,3-5,9H2,1-2H3.
What are the key properties of ethyl 3-amino-2-oxohexanoate?
ethyl 3-amino-2-oxohexanoate has a molecular weight of 173.21 g/mol, XLogP of 0.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-2-oxohexanoate is sourced from PubChem (CID 141339528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).