C16H35N5S — CID 141339702
3,6,9,16,21-pentazabicyclo[16.2.1]henicosane-20-thiol (PubChem CID 141339702) has the molecular formula C16H35N5S and a molecular weight of 329.56 g/mol. Its IUPAC name is 3,6,9,16,21-pentazabicyclo[16.2.1]henicosane-20-thiol.
| Compound Name | 3,6,9,16,21-pentazabicyclo[16.2.1]henicosane-20-thiol |
|---|---|
| PubChem CID | 141339702 |
| Molecular Formula | C16H35N5S |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 3,6,9,16,21-pentazabicyclo[16.2.1]henicosane-20-thiol |
| SMILES | SC1CC2CNCCCCCCNCCNCCNCC1N2 |
| InChI | InChI=1S/C16H35N5S/c22-16-11-14-12-19-6-4-2-1-3-5-17-7-8-18-9-10-20-13-15(16)21-14/h14-22H,1-13H2 |
| InChIKey | IOEHJQBILSFXGW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|