C8H9F3N2O3 — CID 141339796
1,2-dimethylpyridazin-1-ium-3-one;2,2,2-trifluoroacetate (PubChem CID 141339796) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1,2-dimethylpyridazin-1-ium-3-one;2,2,2-trifluoroacetate.
| Compound Name | 1,2-dimethylpyridazin-1-ium-3-one;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141339796 |
| Molecular Formula | C8H9F3N2O3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,2-dimethylpyridazin-1-ium-3-one;2,2,2-trifluoroacetate |
| SMILES | Cn1c(=O)ccc[n+]1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H9N2O.C2HF3O2/c1-7-5-3-4-6(9)8(7)2;3-2(4,5)1(6)7/h3-5H,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | GXQVINAUXKDQCL-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|