C27H26FN5O — CID 141339870
2-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 141339870) has the molecular formula C27H26FN5O and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 141339870 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN1CCN(c2nnc(Cc3ccccc3)c3ccccc23)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FN5O/c28-21-10-12-22(13-11-21)29-26(34)19-32-14-16-33(17-15-32)27-24-9-5-4-8-23(24)25(30-31-27)18-20-6-2-1-3-7-20/h1-13H,14-19H2,(H,29,34) |
| InChIKey | YBYIQQQDNLPCDW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |