About 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one
3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 141342002) has the molecular formula C10H9F3N2O2
and a molecular weight of 246.19 g/mol. Its IUPAC name is 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one |
| PubChem CID | 141342002 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1Cc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)8-5-7(1-2-14-8)6-15-3-4-17-9(15)16/h1-2,5H,3-4,6H2 |
| InChIKey | QSZIOIDPSBMEOW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one (CID 141342002) is 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one is O=C1OCCN1Cc1ccnc(C(F)(F)F)c1.
What is the InChIKey of 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one?
The InChIKey is QSZIOIDPSBMEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O2/c11-10(12,13)8-5-7(1-2-14-8)6-15-3-4-17-9(15)16/h1-2,5H,3-4,6H2.
What are the key properties of 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one?
3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one has a molecular weight of 246.19 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 141342002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).