About dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate
dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate (PubChem CID 141342673) has the molecular formula C26H31BrO4S2
and a molecular weight of 551.57 g/mol. Its IUPAC name is dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate |
| PubChem CID | 141342673 |
| Molecular Formula | C26H31BrO4S2 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1cc(-c2cc3sccc3s2)c(C(=O)OCCCCCC)cc1Br |
| InChI | InChI=1S/C26H31BrO4S2/c1-3-5-7-9-12-30-25(28)19-16-21(27)20(26(29)31-13-10-8-6-4-2)15-18(19)23-17-24-22(33-23)11-14-32-24/h11,14-17H,3-10,12-13H2,1-2H3 |
| InChIKey | LAGXSLGAKSNZHB-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate?
The IUPAC name of dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate (CID 141342673) is dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate.
What is the SMILES notation for dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate?
The canonical SMILES for dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate is CCCCCCOC(=O)c1cc(-c2cc3sccc3s2)c(C(=O)OCCCCCC)cc1Br.
What is the InChIKey of dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate?
The InChIKey is LAGXSLGAKSNZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31BrO4S2/c1-3-5-7-9-12-30-25(28)19-16-21(27)20(26(29)31-13-10-8-6-4-2)15-18(19)23-17-24-22(33-23)11-14-32-24/h11,14-17H,3-10,12-13H2,1-2H3.
What are the key properties of dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate?
dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate has a molecular weight of 551.57 g/mol, XLogP of 8.87, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dihexyl 2-bromo-5-thieno[3,2-b]thiophen-5-ylbenzene-1,4-dicarboxylate is sourced from PubChem (CID 141342673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).