About pyrazolo[1,5-a]pyridin-3-ylmethanol
pyrazolo[1,5-a]pyridin-3-ylmethanol (PubChem CID 14134319) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyridin-3-ylmethanol |
| PubChem CID | 14134319 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | pyrazolo[1,5-a]pyridin-3-ylmethanol |
| SMILES | OCc1cnn2ccccc12 |
| InChI | InChI=1S/C8H8N2O/c11-6-7-5-9-10-4-2-1-3-8(7)10/h1-5,11H,6H2 |
| InChIKey | FYFIBJJWPQYJNJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[1,5-a]pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyridin-3-ylmethanol?
The IUPAC name of pyrazolo[1,5-a]pyridin-3-ylmethanol (CID 14134319) is pyrazolo[1,5-a]pyridin-3-ylmethanol.
What is the SMILES notation for pyrazolo[1,5-a]pyridin-3-ylmethanol?
The canonical SMILES for pyrazolo[1,5-a]pyridin-3-ylmethanol is OCc1cnn2ccccc12.
What is the InChIKey of pyrazolo[1,5-a]pyridin-3-ylmethanol?
The InChIKey is FYFIBJJWPQYJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-6-7-5-9-10-4-2-1-3-8(7)10/h1-5,11H,6H2.
What are the key properties of pyrazolo[1,5-a]pyridin-3-ylmethanol?
pyrazolo[1,5-a]pyridin-3-ylmethanol has a molecular weight of 148.16 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyridin-3-ylmethanol is sourced from PubChem (CID 14134319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).