C14H27NO2Si — CID 141343638
3-[(Z)-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one (PubChem CID 141343638) has the molecular formula C14H27NO2Si and a molecular weight of 269.46 g/mol. Its IUPAC name is 3-[(Z)-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141343638 |
| Molecular Formula | C14H27NO2Si |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3-[(Z)-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](/C=C\N1CCOC1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H27NO2Si/c1-11(2)18(12(3)4,13(5)6)10-8-15-7-9-17-14(15)16/h8,10-13H,7,9H2,1-6H3/b10-8- |
| InChIKey | DSWLYRNMCKFHBX-NTMALXAHSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|