About (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol
(Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol (PubChem CID 14134372) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol |
| PubChem CID | 14134372 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol |
| SMILES | Nc1nccc2c1ncn2C/C=C\CO |
| InChI | InChI=1S/C10H12N4O/c11-10-9-8(3-4-12-10)14(7-13-9)5-1-2-6-15/h1-4,7,15H,5-6H2,(H2,11,12)/b2-1- |
| InChIKey | UPOPWDPXTWJIEQ-UPHRSURJSA-N |
| XLogP | 0.56 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol?
The IUPAC name of (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol (CID 14134372) is (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol.
What is the SMILES notation for (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol?
The canonical SMILES for (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol is Nc1nccc2c1ncn2C/C=C\CO.
What is the InChIKey of (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol?
The InChIKey is UPOPWDPXTWJIEQ-UPHRSURJSA-N. The full InChI is InChI=1S/C10H12N4O/c11-10-9-8(3-4-12-10)14(7-13-9)5-1-2-6-15/h1-4,7,15H,5-6H2,(H2,11,12)/b2-1-.
What are the key properties of (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol?
(Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol has a molecular weight of 204.23 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(4-aminoimidazo[4,5-c]pyridin-1-yl)but-2-en-1-ol is sourced from PubChem (CID 14134372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).