C11H13N5O2S — CID 141343837
2-N-methyl-6-(4-methylsulfonylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 141343837) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-N-methyl-6-(4-methylsulfonylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-methyl-6-(4-methylsulfonylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141343837 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-N-methyl-6-(4-methylsulfonylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N)nc(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C11H13N5O2S/c1-13-11-15-9(14-10(12)16-11)7-3-5-8(6-4-7)19(2,17)18/h3-6H,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | HLXOXFNBFFDTFZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |