C24H26FN3O2 — CID 141344689
(4-fluorophenyl) 3-[[1-methyl-4-(methylamino)cyclohexyl]amino]quinoline-6-carboxylate (PubChem CID 141344689) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is (4-fluorophenyl) 3-[[1-methyl-4-(methylamino)cyclohexyl]amino]quinoline-6-carboxylate.
| Compound Name | (4-fluorophenyl) 3-[[1-methyl-4-(methylamino)cyclohexyl]amino]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344689 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (4-fluorophenyl) 3-[[1-methyl-4-(methylamino)cyclohexyl]amino]quinoline-6-carboxylate |
| SMILES | CNC1CCC(C)(Nc2cnc3ccc(C(=O)Oc4ccc(F)cc4)cc3c2)CC1 |
| InChI | InChI=1S/C24H26FN3O2/c1-24(11-9-19(26-2)10-12-24)28-20-14-17-13-16(3-8-22(17)27-15-20)23(29)30-21-6-4-18(25)5-7-21/h3-8,13-15,19,26,28H,9-12H2,1-2H3 |
| InChIKey | VEUGUJLYVABXPV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|