C13H23NO3 — CID 14134537
(4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-2,2,3-trimethyl-1,3-oxazolidine-4-carboxylic acid (PubChem CID 14134537) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-2,2,3-trimethyl-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-2,2,3-trimethyl-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 14134537 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-2,2,3-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| SMILES | C/C=C/C[C@@H](C)[C@H]1OC(C)(C)N(C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H23NO3/c1-6-7-8-9(2)11-10(12(15)16)14(5)13(3,4)17-11/h6-7,9-11H,8H2,1-5H3,(H,15,16)/b7-6+/t9-,10+,11-/m1/s1 |
| InChIKey | FCHHSNPUHCUTQQ-VONSALPUSA-N |
| XLogP | 2.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|