C15H23N5O2 — CID 141345743
6-[(E)-2-(dimethylamino)ethenyl]-N-methyl-5-nitro-N-piperidin-4-ylpyridin-2-amine (PubChem CID 141345743) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-[(E)-2-(dimethylamino)ethenyl]-N-methyl-5-nitro-N-piperidin-4-ylpyridin-2-amine.
| Compound Name | 6-[(E)-2-(dimethylamino)ethenyl]-N-methyl-5-nitro-N-piperidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 141345743 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 6-[(E)-2-(dimethylamino)ethenyl]-N-methyl-5-nitro-N-piperidin-4-ylpyridin-2-amine |
| SMILES | CN(C)/C=C/c1nc(N(C)C2CCNCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N5O2/c1-18(2)11-8-13-14(20(21)22)4-5-15(17-13)19(3)12-6-9-16-10-7-12/h4-5,8,11-12,16H,6-7,9-10H2,1-3H3/b11-8+ |
| InChIKey | CUOJDCALHPDWHX-DHZHZOJOSA-N |
| XLogP | 1.71 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|