C7H5F7N2O — CID 141346603
5-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrazole (PubChem CID 141346603) has the molecular formula C7H5F7N2O and a molecular weight of 266.12 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrazole.
| Compound Name | 5-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrazole |
|---|---|
| PubChem CID | 141346603 |
| Molecular Formula | C7H5F7N2O |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 5-(2,2,3,3,4,4,4-heptafluorobutoxy)-1H-pyrazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COc1ccn[nH]1 |
| InChI | InChI=1S/C7H5F7N2O/c8-5(9,6(10,11)7(12,13)14)3-17-4-1-2-15-16-4/h1-2H,3H2,(H,15,16) |
| InChIKey | CXHFGQQAKWXEIV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|