About 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole
1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole (PubChem CID 141347408) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole.
Molecular Properties
| Compound Name | 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole |
| PubChem CID | 141347408 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole |
| SMILES | C[C@H]1CCCN1C[C@H]1C[C@@H]1c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-15-5-4-12-21(15)14-17-13-19(17)16-6-8-18(9-7-16)20-10-2-3-11-20/h2-3,6-11,15,17,19H,4-5,12-14H2,1H3/t15-,17+,19+/m0/s1 |
| InChIKey | BGUQEBWPBGZTOQ-KVSKMBFKSA-N |
| XLogP | 4.07 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole?
The IUPAC name of 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole (CID 141347408) is 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole.
What is the SMILES notation for 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole?
The canonical SMILES for 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole is C[C@H]1CCCN1C[C@H]1C[C@@H]1c1ccc(-n2cccc2)cc1.
What is the InChIKey of 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole?
The InChIKey is BGUQEBWPBGZTOQ-KVSKMBFKSA-N. The full InChI is InChI=1S/C19H24N2/c1-15-5-4-12-21(15)14-17-13-19(17)16-6-8-18(9-7-16)20-10-2-3-11-20/h2-3,6-11,15,17,19H,4-5,12-14H2,1H3/t15-,17+,19+/m0/s1.
What are the key properties of 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole?
1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole has a molecular weight of 280.42 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1S,2S)-2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]pyrrole is sourced from PubChem (CID 141347408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).