About 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene
5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 141347739) has the molecular formula C8H7F3INO3
and a molecular weight of 349.05 g/mol. Its IUPAC name is 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 141347739 |
| Molecular Formula | C8H7F3INO3 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | COC1=CC(C(F)(F)F)C(I)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C8H7F3INO3/c1-16-5-2-3-7(12,13(14)15)6(4-5)8(9,10)11/h2-4,6H,1H3 |
| InChIKey | XTZBZVZGGNWPIO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene (CID 141347739) is 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene is COC1=CC(C(F)(F)F)C(I)([N+](=O)[O-])C=C1.
What is the InChIKey of 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is XTZBZVZGGNWPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3INO3/c1-16-5-2-3-7(12,13(14)15)6(4-5)8(9,10)11/h2-4,6H,1H3.
What are the key properties of 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene?
5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 349.05 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-methoxy-5-nitro-6-(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 141347739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).