C16H22O6 — CID 141347886
3,3,5-triacetyldecane-2,4,9-trione (PubChem CID 141347886) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3,3,5-triacetyldecane-2,4,9-trione.
| Compound Name | 3,3,5-triacetyldecane-2,4,9-trione |
|---|---|
| PubChem CID | 141347886 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3,3,5-triacetyldecane-2,4,9-trione |
| SMILES | CC(=O)CCCC(C(C)=O)C(=O)C(C(C)=O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C16H22O6/c1-9(17)7-6-8-14(10(2)18)15(22)16(11(3)19,12(4)20)13(5)21/h14H,6-8H2,1-5H3 |
| InChIKey | XGHIGHHJIJOIBL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|