About 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane
1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane (PubChem CID 141348196) has the molecular formula C18H34P2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane.
Molecular Properties
| Compound Name | 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane |
| PubChem CID | 141348196 |
| Molecular Formula | C18H34P2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane |
| SMILES | CC1(C)CCCP1C1(P2CCCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C18H34P2/c1-16(2)10-8-14-19(16)18(12-6-5-7-13-18)20-15-9-11-17(20,3)4/h5-15H2,1-4H3 |
| InChIKey | WACGAFNBUXYEJQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane?
The IUPAC name of 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane (CID 141348196) is 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane.
What is the SMILES notation for 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane?
The canonical SMILES for 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane is CC1(C)CCCP1C1(P2CCCC2(C)C)CCCCC1.
What is the InChIKey of 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane?
The InChIKey is WACGAFNBUXYEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34P2/c1-16(2)10-8-14-19(16)18(12-6-5-7-13-18)20-15-9-11-17(20,3)4/h5-15H2,1-4H3.
What are the key properties of 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane?
1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane has a molecular weight of 312.42 g/mol, XLogP of 6.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2-dimethylphospholan-1-yl)cyclohexyl]-2,2-dimethylphospholane is sourced from PubChem (CID 141348196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).