C16H22N4 — CID 141348331
1-methyl-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine (PubChem CID 141348331) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-methyl-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 141348331 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-methyl-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine |
| SMILES | CN1CCN(Cc2cccc(Cn3cccn3)c2)CC1 |
| InChI | InChI=1S/C16H22N4/c1-18-8-10-19(11-9-18)13-15-4-2-5-16(12-15)14-20-7-3-6-17-20/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | QNGPCTATBPTKDX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |