About 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene
3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene (PubChem CID 141348346) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene.
Molecular Properties
| Compound Name | 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene |
| PubChem CID | 141348346 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene |
| SMILES | CCn1ncc2cc(C3=NOC4(CCCCC4)C3)cnc21 |
| InChI | InChI=1S/C16H20N4O/c1-2-20-15-13(11-18-20)8-12(10-17-15)14-9-16(21-19-14)6-4-3-5-7-16/h8,10-11H,2-7,9H2,1H3 |
| InChIKey | UEVWCJPCIJFDOD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The IUPAC name of 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene (CID 141348346) is 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene.
What is the SMILES notation for 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The canonical SMILES for 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene is CCn1ncc2cc(C3=NOC4(CCCCC4)C3)cnc21.
What is the InChIKey of 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The InChIKey is UEVWCJPCIJFDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-2-20-15-13(11-18-20)8-12(10-17-15)14-9-16(21-19-14)6-4-3-5-7-16/h8,10-11H,2-7,9H2,1H3.
What are the key properties of 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene has a molecular weight of 284.36 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethylpyrazolo[3,4-b]pyridin-5-yl)-1-oxa-2-azaspiro[4.5]dec-2-ene is sourced from PubChem (CID 141348346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).