C13H13ClO8 — CID 141348446
(E)-3-(3,4-diacetyloxy-5-chloro-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 141348446) has the molecular formula C13H13ClO8 and a molecular weight of 332.69 g/mol. Its IUPAC name is (E)-3-(3,4-diacetyloxy-5-chloro-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,4-diacetyloxy-5-chloro-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 141348446 |
| Molecular Formula | C13H13ClO8 |
| Molecular Weight | 332.69 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (E)-3-(3,4-diacetyloxy-5-chloro-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | CC(=O)OC1(O)C=C(/C=C/C(=O)O)C=C(Cl)C1(O)OC(C)=O |
| InChI | InChI=1S/C13H13ClO8/c1-7(15)21-12(19)6-9(3-4-11(17)18)5-10(14)13(12,20)22-8(2)16/h3-6,19-20H,1-2H3,(H,17,18)/b4-3+ |
| InChIKey | BNGGTEAEYOZUTE-ONEGZZNKSA-N |
| XLogP | 0.19 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.69 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|