C73H73N3O2 — CID 141348522
[1-(1H-indol-3-yl)-2-methyl-3,7-diphenylheptan-3-yl] 2-benzyl-2-(1H-indol-3-yl)-3-[1-(1H-indol-2-yl)ethyl]-6-phenyl-3-(2-phenylethyl)hexanoate (PubChem CID 141348522) has the molecular formula C73H73N3O2 and a molecular weight of 1024.41 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)-2-methyl-3,7-diphenylheptan-3-yl] 2-benzyl-2-(1H-indol-3-yl)-3-[1-(1H-indol-2-yl)ethyl]-6-phenyl-3-(2-phenylethyl)hexanoate.
| Compound Name | [1-(1H-indol-3-yl)-2-methyl-3,7-diphenylheptan-3-yl] 2-benzyl-2-(1H-indol-3-yl)-3-[1-(1H-indol-2-yl)ethyl]-6-phenyl-3-(2-phenylethyl)hexanoate |
|---|---|
| PubChem CID | 141348522 |
| Molecular Formula | C73H73N3O2 |
| Molecular Weight | 1024.41 g/mol |
| Exact Mass | 1023.57 |
| IUPAC Name | [1-(1H-indol-3-yl)-2-methyl-3,7-diphenylheptan-3-yl] 2-benzyl-2-(1H-indol-3-yl)-3-[1-(1H-indol-2-yl)ethyl]-6-phenyl-3-(2-phenylethyl)hexanoate |
| SMILES | CC(Cc1c[nH]c2ccccc12)C(CCCCc1ccccc1)(OC(=O)C(Cc1ccccc1)(c1c[nH]c2ccccc12)C(CCCc1ccccc1)(CCc1ccccc1)C(C)c1cc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C73H73N3O2/c1-54(49-61-52-74-67-43-22-19-40-63(61)67)73(62-38-16-7-17-39-62,47-25-24-33-56-27-8-3-9-28-56)78-70(77)72(51-59-34-14-6-15-35-59,65-53-75-68-44-23-20-41-64(65)68)71(48-45-58-31-12-5-13-32-58,46-26-36-57-29-10-4-11-30-57)55(2)69-50-60-37-18-21-42-66(60)76-69/h3-23,27-32,34-35,37-44,50,52-55,74-76H,24-26,33,36,45-49,51H2,1-2H3 |
| InChIKey | XHNOKSILOSBELS-UHFFFAOYSA-N |
| XLogP | 17.79 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.41 |
| LogP ≤ 5 | 17.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|