About 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide
2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 141348905) has the molecular formula C4H4F3NO3S
and a molecular weight of 203.14 g/mol. Its IUPAC name is 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 141348905 |
| Molecular Formula | C4H4F3NO3S |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(C=S(=O)=O)NCC(F)(F)F |
| InChI | InChI=1S/C4H4F3NO3S/c5-4(6,7)2-8-3(9)1-12(10)11/h1H,2H2,(H,8,9) |
| InChIKey | PWNKDXZUIOVGME-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide (CID 141348905) is 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide is O=C(C=S(=O)=O)NCC(F)(F)F.
What is the InChIKey of 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is PWNKDXZUIOVGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F3NO3S/c5-4(6,7)2-8-3(9)1-12(10)11/h1H,2H2,(H,8,9).
What are the key properties of 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide?
2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 203.14 g/mol, XLogP of -0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonyl-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 141348905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).