About 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole
3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 141349448) has the molecular formula C16H14Cl2F3NO
and a molecular weight of 364.19 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| PubChem CID | 141349448 |
| Molecular Formula | C16H14Cl2F3NO |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)CC(C2=CCCCC2)=NO1 |
| InChI | InChI=1S/C16H14Cl2F3NO/c17-12-6-11(7-13(18)8-12)15(16(19,20)21)9-14(22-23-15)10-4-2-1-3-5-10/h4,6-8H,1-3,5,9H2 |
| InChIKey | ZRZUVXQTMOGIEE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The IUPAC name of 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (CID 141349448) is 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
What is the SMILES notation for 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The canonical SMILES for 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)CC(C2=CCCCC2)=NO1.
What is the InChIKey of 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The InChIKey is ZRZUVXQTMOGIEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2F3NO/c17-12-6-11(7-13(18)8-12)15(16(19,20)21)9-14(22-23-15)10-4-2-1-3-5-10/h4,6-8H,1-3,5,9H2.
What are the key properties of 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole has a molecular weight of 364.19 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is sourced from PubChem (CID 141349448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).