C6H12N4 — CID 141349880
N,N-dimethyl-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 141349880) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is N,N-dimethyl-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 141349880 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | N,N-dimethyl-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CN(C)CCc1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4/c1-10(2)4-3-6-7-5-8-9-6/h5H,3-4H2,1-2H3,(H,7,8,9) |
| InChIKey | AYVQMXNGTNYCER-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |