C23H42O4 — CID 141349947
18-(2,2-dimethylpropoxy)-18-oxooctadec-9-enoic acid (PubChem CID 141349947) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is 18-(2,2-dimethylpropoxy)-18-oxooctadec-9-enoic acid.
| Compound Name | 18-(2,2-dimethylpropoxy)-18-oxooctadec-9-enoic acid |
|---|---|
| PubChem CID | 141349947 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 18-(2,2-dimethylpropoxy)-18-oxooctadec-9-enoic acid |
| SMILES | CC(C)(C)COC(=O)CCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H42O4/c1-23(2,3)20-27-22(26)19-17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-21(24)25/h4-5H,6-20H2,1-3H3,(H,24,25) |
| InChIKey | BXMCOLRATCGCIN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|