About tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate
tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate (PubChem CID 141350104) has the molecular formula C36H24N4O8Sn
and a molecular weight of 759.32 g/mol. Its IUPAC name is tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate |
| PubChem CID | 141350104 |
| Molecular Formula | C36H24N4O8Sn |
| Molecular Weight | 759.32 g/mol |
| Exact Mass | 760.06 |
| IUPAC Name | tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate |
| SMILES | O=C(O[Sn](OC(=O)c1c[nH]c2ccccc12)(OC(=O)c1c[nH]c2ccccc12)OC(=O)c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/4C9H7NO2.Sn/c4*11-9(12)7-5-10-8-4-2-1-3-6(7)8;/h4*1-5,10H,(H,11,12);/q;;;;+4/p-4 |
| InChIKey | ZWOKVDRUBPTWSK-UHFFFAOYSA-J |
| XLogP | 6.78 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 759.32 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate?
The IUPAC name of tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate (CID 141350104) is tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate.
What is the SMILES notation for tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate?
The canonical SMILES for tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate is O=C(O[Sn](OC(=O)c1c[nH]c2ccccc12)(OC(=O)c1c[nH]c2ccccc12)OC(=O)c1c[nH]c2ccccc12)c1c[nH]c2ccccc12.
What is the InChIKey of tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate?
The InChIKey is ZWOKVDRUBPTWSK-UHFFFAOYSA-J. The full InChI is InChI=1S/4C9H7NO2.Sn/c4*11-9(12)7-5-10-8-4-2-1-3-6(7)8;/h4*1-5,10H,(H,11,12);/q;;;;+4/p-4.
What are the key properties of tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate?
tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate has a molecular weight of 759.32 g/mol, XLogP of 6.78, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris(1H-indole-3-carbonyloxy)stannyl 1H-indole-3-carboxylate is sourced from PubChem (CID 141350104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).