C111H171O6P — CID 141350425
tris[1,1-bis(2,4-ditert-butylphenyl)-6-methyl-2-methylideneheptoxy] phosphite (PubChem CID 141350425) has the molecular formula C111H171O6P and a molecular weight of 1632.56 g/mol. Its IUPAC name is tris[1,1-bis(2,4-ditert-butylphenyl)-6-methyl-2-methylideneheptoxy] phosphite.
| Compound Name | tris[1,1-bis(2,4-ditert-butylphenyl)-6-methyl-2-methylideneheptoxy] phosphite |
|---|---|
| PubChem CID | 141350425 |
| Molecular Formula | C111H171O6P |
| Molecular Weight | 1632.56 g/mol |
| Exact Mass | 1631.28 |
| IUPAC Name | tris[1,1-bis(2,4-ditert-butylphenyl)-6-methyl-2-methylideneheptoxy] phosphite |
| SMILES | C=C(CCCC(C)C)C(OOP(OOC(C(=C)CCCC(C)C)(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C)OOC(C(=C)CCCC(C)C)(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C)(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C111H171O6P/c1-73(2)49-46-52-76(7)109(85-61-55-79(97(10,11)12)67-91(85)103(28,29)30,86-62-56-80(98(13,14)15)68-92(86)104(31,32)33)112-115-118(116-113-110(77(8)53-47-50-74(3)4,87-63-57-81(99(16,17)18)69-93(87)105(34,35)36)88-64-58-82(100(19,20)21)70-94(88)106(37,38)39)117-114-111(78(9)54-48-51-75(5)6,89-65-59-83(101(22,23)24)71-95(89)107(40,41)42)90-66-60-84(102(25,26)27)72-96(90)108(43,44)45/h55-75H,7-9,46-54H2,1-6,10-45H3 |
| InChIKey | NOWVGDZQKZLMBH-UHFFFAOYSA-N |
| XLogP | 33.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 118 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1632.56 |
| LogP ≤ 5 | 33.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|