C12H18N2O4S — CID 141350454
5-(2-carbamimidoylphenoxy)pentane-1-sulfonic acid (PubChem CID 141350454) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 5-(2-carbamimidoylphenoxy)pentane-1-sulfonic acid.
| Compound Name | 5-(2-carbamimidoylphenoxy)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 141350454 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(2-carbamimidoylphenoxy)pentane-1-sulfonic acid |
| SMILES | [H]/N=C(\N)c1ccccc1OCCCCCS(=O)(=O)O |
| InChI | InChI=1S/C12H18N2O4S/c13-12(14)10-6-2-3-7-11(10)18-8-4-1-5-9-19(15,16)17/h2-3,6-7H,1,4-5,8-9H2,(H3,13,14)(H,15,16,17) |
| InChIKey | AGPXUSXIZJMXJM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|